About 2-(3-aminopropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one
2-(3-aminopropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one (PubChem CID 136693536) has the molecular formula C9H13N3O2
and a molecular weight of 195.22 g/mol. Its IUPAC name is 2-(3-aminopropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-(3-aminopropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one |
| PubChem CID | 136693536 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 2-(3-aminopropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one |
| SMILES | NCCCc1nc2c(c(=O)[nH]1)COC2 |
| InChI | InChI=1S/C9H13N3O2/c10-3-1-2-8-11-7-5-14-4-6(7)9(13)12-8/h1-5,10H2,(H,11,12,13) |
| InChIKey | KWYBVMIJEQVSTN-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-aminopropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-aminopropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one?
The IUPAC name of 2-(3-aminopropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one (CID 136693536) is 2-(3-aminopropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one.
What is the SMILES notation for 2-(3-aminopropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one?
The canonical SMILES for 2-(3-aminopropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one is NCCCc1nc2c(c(=O)[nH]1)COC2.
What is the InChIKey of 2-(3-aminopropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one?
The InChIKey is KWYBVMIJEQVSTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2/c10-3-1-2-8-11-7-5-14-4-6(7)9(13)12-8/h1-5,10H2,(H,11,12,13).
What are the key properties of 2-(3-aminopropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one?
2-(3-aminopropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one has a molecular weight of 195.22 g/mol, XLogP of -0.31, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-aminopropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one is sourced from PubChem (CID 136693536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).