About 2-(3-hydroxypropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one
2-(3-hydroxypropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one (PubChem CID 136693546) has the molecular formula C9H12N2O3
and a molecular weight of 196.21 g/mol. Its IUPAC name is 2-(3-hydroxypropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-(3-hydroxypropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one |
| PubChem CID | 136693546 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 2-(3-hydroxypropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CCCO)nc2c1COC2 |
| InChI | InChI=1S/C9H12N2O3/c12-3-1-2-8-10-7-5-14-4-6(7)9(13)11-8/h12H,1-5H2,(H,10,11,13) |
| InChIKey | VWSBXDXWALSWTR-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-hydroxypropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-hydroxypropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one?
The IUPAC name of 2-(3-hydroxypropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one (CID 136693546) is 2-(3-hydroxypropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one.
What is the SMILES notation for 2-(3-hydroxypropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one?
The canonical SMILES for 2-(3-hydroxypropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one is O=c1[nH]c(CCCO)nc2c1COC2.
What is the InChIKey of 2-(3-hydroxypropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one?
The InChIKey is VWSBXDXWALSWTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3/c12-3-1-2-8-10-7-5-14-4-6(7)9(13)11-8/h12H,1-5H2,(H,10,11,13).
What are the key properties of 2-(3-hydroxypropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one?
2-(3-hydroxypropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one has a molecular weight of 196.21 g/mol, XLogP of -0.28, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-hydroxypropyl)-5,7-dihydro-3H-furo[3,4-d]pyrimidin-4-one is sourced from PubChem (CID 136693546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).