About CID 136693836
CID 136693836 (PubChem CID 136693836) has the molecular formula C48H27F12N4+
and a molecular weight of 887.75 g/mol.
Molecular Properties
| Compound Name | CID 136693836 |
| PubChem CID | 136693836 |
| Molecular Formula | C48H27F12N4+ |
| Molecular Weight | 887.75 g/mol |
| Exact Mass | 887.20 |
| IUPAC Name | — |
| SMILES | FC(F)(F)c1ccc(C2=C/C3=c4\cc(-c5ccc(C(F)(F)F)cc5)/c([nH]4)=C/C=c4\[nH]/c(cc4-c4ccc(C(F)(F)F)cc4)=C4/[CH+]C(c5ccc(C(F)(F)F)cc5)=C(/C=C\C2=N3)N4)cc1 |
| InChI | InChI=1S/C48H27F12N4/c49-45(50,51)29-9-1-25(2-10-29)33-21-41-42-22-34(26-3-11-30(12-4-26)46(52,53)54)39(62-42)19-20-40-36(28-7-15-32(16-8-28)48(58,59)60)24-44(64-40)43-23-35(38(63-43)18-17-37(33)61-41)27-5-13-31(14-6-27)47(55,56)57/h1-24,61-63H/q+1/b20-19-,37-17-,38-18-,42-41-,44-43- |
| InChIKey | MHBYYOICXONWSH-GOCBBSDGSA-N |
| XLogP | 10.56 |
| TPSA | 55.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 887.75 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 136693836 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136693836?
The IUPAC name of CID 136693836 (CID 136693836) is not available.
What is the SMILES notation for CID 136693836?
The canonical SMILES for CID 136693836 is FC(F)(F)c1ccc(C2=C/C3=c4\cc(-c5ccc(C(F)(F)F)cc5)/c([nH]4)=C/C=c4\[nH]/c(cc4-c4ccc(C(F)(F)F)cc4)=C4/[CH+]C(c5ccc(C(F)(F)F)cc5)=C(/C=C\C2=N3)N4)cc1.
What is the InChIKey of CID 136693836?
The InChIKey is MHBYYOICXONWSH-GOCBBSDGSA-N. The full InChI is InChI=1S/C48H27F12N4/c49-45(50,51)29-9-1-25(2-10-29)33-21-41-42-22-34(26-3-11-30(12-4-26)46(52,53)54)39(62-42)19-20-40-36(28-7-15-32(16-8-28)48(58,59)60)24-44(64-40)43-23-35(38(63-43)18-17-37(33)61-41)27-5-13-31(14-6-27)47(55,56)57/h1-24,61-63H/q+1/b20-19-,37-17-,38-18-,42-41-,44-43-.
What are the key properties of CID 136693836?
CID 136693836 has a molecular weight of 887.75 g/mol, XLogP of 10.56, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136693836 is sourced from PubChem (CID 136693836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).