C18H14N2O4S2 — CID 136694851
(2R)-2-[3-(1,3-benzothiazol-2-yl)-5-formyl-2-hydroxyphenyl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 136694851) has the molecular formula C18H14N2O4S2 and a molecular weight of 386.45 g/mol. Its IUPAC name is (2R)-2-[3-(1,3-benzothiazol-2-yl)-5-formyl-2-hydroxyphenyl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (2R)-2-[3-(1,3-benzothiazol-2-yl)-5-formyl-2-hydroxyphenyl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 136694851 |
| Molecular Formula | C18H14N2O4S2 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | (2R)-2-[3-(1,3-benzothiazol-2-yl)-5-formyl-2-hydroxyphenyl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=Cc1cc(-c2nc3ccccc3s2)c(O)c([C@@H]2NC(C(=O)O)CS2)c1 |
| InChI | InChI=1S/C18H14N2O4S2/c21-7-9-5-10(16-20-13(8-25-16)18(23)24)15(22)11(6-9)17-19-12-3-1-2-4-14(12)26-17/h1-7,13,16,20,22H,8H2,(H,23,24)/t13?,16-/m1/s1 |
| InChIKey | KQAPRBWOAHYKAU-FQNRMIAFSA-N |
| XLogP | 3.27 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|