C13H18N2O2 — CID 136696285
2-cyclohexyl-3,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one (PubChem CID 136696285) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-cyclohexyl-3,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one.
| Compound Name | 2-cyclohexyl-3,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136696285 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 2-cyclohexyl-3,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(C2CCCCC2)nc2c1COCC2 |
| InChI | InChI=1S/C13H18N2O2/c16-13-10-8-17-7-6-11(10)14-12(15-13)9-4-2-1-3-5-9/h9H,1-8H2,(H,14,15,16) |
| InChIKey | GJPIFKQQIGPRDD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |