C9H9F3N2O2 — CID 136696335
2-(2,2,2-trifluoroethyl)-3,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one (PubChem CID 136696335) has the molecular formula C9H9F3N2O2 and a molecular weight of 234.18 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethyl)-3,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one.
| Compound Name | 2-(2,2,2-trifluoroethyl)-3,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136696335 |
| Molecular Formula | C9H9F3N2O2 |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 2-(2,2,2-trifluoroethyl)-3,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CC(F)(F)F)nc2c1COCC2 |
| InChI | InChI=1S/C9H9F3N2O2/c10-9(11,12)3-7-13-6-1-2-16-4-5(6)8(15)14-7/h1-4H2,(H,13,14,15) |
| InChIKey | URHGJMPDVKDBCF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |