C16H18N2O2 — CID 136696454
2-(2,4,6-trimethylphenyl)-3,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one (PubChem CID 136696454) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-(2,4,6-trimethylphenyl)-3,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one.
| Compound Name | 2-(2,4,6-trimethylphenyl)-3,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136696454 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-(2,4,6-trimethylphenyl)-3,5,7,8-tetrahydropyrano[4,3-d]pyrimidin-4-one |
| SMILES | Cc1cc(C)c(-c2nc3c(c(=O)[nH]2)COCC3)c(C)c1 |
| InChI | InChI=1S/C16H18N2O2/c1-9-6-10(2)14(11(3)7-9)15-17-13-4-5-20-8-12(13)16(19)18-15/h6-7H,4-5,8H2,1-3H3,(H,17,18,19) |
| InChIKey | DPJMPWXCQXAKBS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |