C12H18IN3O2 — CID 136696620
4-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-5-iodo-1H-pyrimidin-6-one (PubChem CID 136696620) has the molecular formula C12H18IN3O2 and a molecular weight of 363.20 g/mol. Its IUPAC name is 4-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 4-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136696620 |
| Molecular Formula | C12H18IN3O2 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 4-[(3-ethoxy-2,2-dimethylcyclobutyl)amino]-5-iodo-1H-pyrimidin-6-one |
| SMILES | CCOC1CC(Nc2nc[nH]c(=O)c2I)C1(C)C |
| InChI | InChI=1S/C12H18IN3O2/c1-4-18-8-5-7(12(8,2)3)16-10-9(13)11(17)15-6-14-10/h6-8H,4-5H2,1-3H3,(H2,14,15,16,17) |
| InChIKey | KGIUUFHTWUUBLL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|