C19H14N8O2 — CID 136698398
2,5-diamino-7-(4-hydroxyphenyl)-3-[(4-hydroxyphenyl)diazenyl]pyrazolo[1,5-a]pyrimidine-6-carbonitrile (PubChem CID 136698398) has the molecular formula C19H14N8O2 and a molecular weight of 386.38 g/mol. Its IUPAC name is 2,5-diamino-7-(4-hydroxyphenyl)-3-[(4-hydroxyphenyl)diazenyl]pyrazolo[1,5-a]pyrimidine-6-carbonitrile.
| Compound Name | 2,5-diamino-7-(4-hydroxyphenyl)-3-[(4-hydroxyphenyl)diazenyl]pyrazolo[1,5-a]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 136698398 |
| Molecular Formula | C19H14N8O2 |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 2,5-diamino-7-(4-hydroxyphenyl)-3-[(4-hydroxyphenyl)diazenyl]pyrazolo[1,5-a]pyrimidine-6-carbonitrile |
| SMILES | N#Cc1c(N)nc2c(/N=N/c3ccc(O)cc3)c(N)nn2c1-c1ccc(O)cc1 |
| InChI | InChI=1S/C19H14N8O2/c20-9-14-16(10-1-5-12(28)6-2-10)27-19(23-17(14)21)15(18(22)26-27)25-24-11-3-7-13(29)8-4-11/h1-8,28-29H,(H2,21,23)(H2,22,26)/b25-24+ |
| InChIKey | UTJSDVZRLNPHSR-OCOZRVBESA-N |
| XLogP | 3.26 |
| TPSA | 171.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|