C16H27N3O3 — CID 136698874
2-tert-butyl-N-(2-hydroxy-4-methylpentyl)-4-methyl-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 136698874) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-tert-butyl-N-(2-hydroxy-4-methylpentyl)-4-methyl-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | 2-tert-butyl-N-(2-hydroxy-4-methylpentyl)-4-methyl-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136698874 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 2-tert-butyl-N-(2-hydroxy-4-methylpentyl)-4-methyl-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | Cc1nc(C(C)(C)C)[nH]c(=O)c1C(=O)NCC(O)CC(C)C |
| InChI | InChI=1S/C16H27N3O3/c1-9(2)7-11(20)8-17-13(21)12-10(3)18-15(16(4,5)6)19-14(12)22/h9,11,20H,7-8H2,1-6H3,(H,17,21)(H,18,19,22) |
| InChIKey | AQSLHLDGBFPWEN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |