About 3-(2-methylphenyl)-2,1-benzoxazol-6-ol
3-(2-methylphenyl)-2,1-benzoxazol-6-ol (PubChem CID 136699555) has the molecular formula C14H11NO2
and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-(2-methylphenyl)-2,1-benzoxazol-6-ol.
Molecular Properties
| Compound Name | 3-(2-methylphenyl)-2,1-benzoxazol-6-ol |
| PubChem CID | 136699555 |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 3-(2-methylphenyl)-2,1-benzoxazol-6-ol |
| SMILES | Cc1ccccc1-c1onc2cc(O)ccc12 |
| InChI | InChI=1S/C14H11NO2/c1-9-4-2-3-5-11(9)14-12-7-6-10(16)8-13(12)15-17-14/h2-8,16H,1H3 |
| InChIKey | MYGAQEKVICYLFG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-methylphenyl)-2,1-benzoxazol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methylphenyl)-2,1-benzoxazol-6-ol?
The IUPAC name of 3-(2-methylphenyl)-2,1-benzoxazol-6-ol (CID 136699555) is 3-(2-methylphenyl)-2,1-benzoxazol-6-ol.
What is the SMILES notation for 3-(2-methylphenyl)-2,1-benzoxazol-6-ol?
The canonical SMILES for 3-(2-methylphenyl)-2,1-benzoxazol-6-ol is Cc1ccccc1-c1onc2cc(O)ccc12.
What is the InChIKey of 3-(2-methylphenyl)-2,1-benzoxazol-6-ol?
The InChIKey is MYGAQEKVICYLFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO2/c1-9-4-2-3-5-11(9)14-12-7-6-10(16)8-13(12)15-17-14/h2-8,16H,1H3.
What are the key properties of 3-(2-methylphenyl)-2,1-benzoxazol-6-ol?
3-(2-methylphenyl)-2,1-benzoxazol-6-ol has a molecular weight of 225.25 g/mol, XLogP of 3.51, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylphenyl)-2,1-benzoxazol-6-ol is sourced from PubChem (CID 136699555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).