About 4-[3-(3-hydroxypropyl)-1,2,4-triazin-5-yl]phenol
4-[3-(3-hydroxypropyl)-1,2,4-triazin-5-yl]phenol (PubChem CID 136699767) has the molecular formula C12H13N3O2
and a molecular weight of 231.25 g/mol. Its IUPAC name is 4-[3-(3-hydroxypropyl)-1,2,4-triazin-5-yl]phenol.
Molecular Properties
| Compound Name | 4-[3-(3-hydroxypropyl)-1,2,4-triazin-5-yl]phenol |
| PubChem CID | 136699767 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 4-[3-(3-hydroxypropyl)-1,2,4-triazin-5-yl]phenol |
| SMILES | OCCCc1nncc(-c2ccc(O)cc2)n1 |
| InChI | InChI=1S/C12H13N3O2/c16-7-1-2-12-14-11(8-13-15-12)9-3-5-10(17)6-4-9/h3-6,8,16-17H,1-2,7H2 |
| InChIKey | RBUGELQGVJZLMP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 79.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[3-(3-hydroxypropyl)-1,2,4-triazin-5-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(3-hydroxypropyl)-1,2,4-triazin-5-yl]phenol?
The IUPAC name of 4-[3-(3-hydroxypropyl)-1,2,4-triazin-5-yl]phenol (CID 136699767) is 4-[3-(3-hydroxypropyl)-1,2,4-triazin-5-yl]phenol.
What is the SMILES notation for 4-[3-(3-hydroxypropyl)-1,2,4-triazin-5-yl]phenol?
The canonical SMILES for 4-[3-(3-hydroxypropyl)-1,2,4-triazin-5-yl]phenol is OCCCc1nncc(-c2ccc(O)cc2)n1.
What is the InChIKey of 4-[3-(3-hydroxypropyl)-1,2,4-triazin-5-yl]phenol?
The InChIKey is RBUGELQGVJZLMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O2/c16-7-1-2-12-14-11(8-13-15-12)9-3-5-10(17)6-4-9/h3-6,8,16-17H,1-2,7H2.
What are the key properties of 4-[3-(3-hydroxypropyl)-1,2,4-triazin-5-yl]phenol?
4-[3-(3-hydroxypropyl)-1,2,4-triazin-5-yl]phenol has a molecular weight of 231.25 g/mol, XLogP of 1.17, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(3-hydroxypropyl)-1,2,4-triazin-5-yl]phenol is sourced from PubChem (CID 136699767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).