C23H20BrN9 — CID 136700612
4-N-(4-bromophenyl)-6-(3,5-dimethylpyrazol-1-yl)-2-N-[(Z)-1H-indol-3-ylmethylideneamino]-1,3,5-triazine-2,4-diamine (PubChem CID 136700612) has the molecular formula C23H20BrN9 and a molecular weight of 502.38 g/mol. Its IUPAC name is 4-N-(4-bromophenyl)-6-(3,5-dimethylpyrazol-1-yl)-2-N-[(Z)-1H-indol-3-ylmethylideneamino]-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-(4-bromophenyl)-6-(3,5-dimethylpyrazol-1-yl)-2-N-[(Z)-1H-indol-3-ylmethylideneamino]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 136700612 |
| Molecular Formula | C23H20BrN9 |
| Molecular Weight | 502.38 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | 4-N-(4-bromophenyl)-6-(3,5-dimethylpyrazol-1-yl)-2-N-[(Z)-1H-indol-3-ylmethylideneamino]-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1cc(C)n(-c2nc(N/N=C\c3c[nH]c4ccccc34)nc(Nc3ccc(Br)cc3)n2)n1 |
| InChI | InChI=1S/C23H20BrN9/c1-14-11-15(2)33(32-14)23-29-21(27-18-9-7-17(24)8-10-18)28-22(30-23)31-26-13-16-12-25-20-6-4-3-5-19(16)20/h3-13,25H,1-2H3,(H2,27,28,29,30,31)/b26-13- |
| InChIKey | IURILPBTKYVLGP-ZMFRSBBQSA-N |
| XLogP | 5.11 |
| TPSA | 108.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.38 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_A(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|