C22H22N2O4S — CID 136700653
4-[[(3R)-1,1-dioxothiolan-3-yl]iminomethyl]-2-(2-ethylphenyl)-3-hydroxyisoquinolin-1-one (PubChem CID 136700653) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is 4-[[(3R)-1,1-dioxothiolan-3-yl]iminomethyl]-2-(2-ethylphenyl)-3-hydroxyisoquinolin-1-one.
| Compound Name | 4-[[(3R)-1,1-dioxothiolan-3-yl]iminomethyl]-2-(2-ethylphenyl)-3-hydroxyisoquinolin-1-one |
|---|---|
| PubChem CID | 136700653 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 4-[[(3R)-1,1-dioxothiolan-3-yl]iminomethyl]-2-(2-ethylphenyl)-3-hydroxyisoquinolin-1-one |
| SMILES | CCc1ccccc1-n1c(O)c(/C=N/[C@@H]2CCS(=O)(=O)C2)c2ccccc2c1=O |
| InChI | InChI=1S/C22H22N2O4S/c1-2-15-7-3-6-10-20(15)24-21(25)18-9-5-4-8-17(18)19(22(24)26)13-23-16-11-12-29(27,28)14-16/h3-10,13,16,26H,2,11-12,14H2,1H3/b23-13+/t16-/m1/s1 |
| InChIKey | MTUMIWUZQANXQK-DXRSZSRVSA-N |
| XLogP | 2.86 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|