C21H21N5O5S — CID 136701490
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetamide (PubChem CID 136701490) has the molecular formula C21H21N5O5S and a molecular weight of 455.50 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetamide.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 136701490 |
| Molecular Formula | C21H21N5O5S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[(4R)-4-methyl-2,5-dioxo-4-(2-phenylethyl)imidazolidin-1-yl]acetamide |
| SMILES | C[C@]1(CCc2ccccc2)NC(=O)N(NC(=O)C/N=C2\NS(=O)(=O)c3ccccc32)C1=O |
| InChI | InChI=1S/C21H21N5O5S/c1-21(12-11-14-7-3-2-4-8-14)19(28)26(20(29)23-21)24-17(27)13-22-18-15-9-5-6-10-16(15)32(30,31)25-18/h2-10H,11-13H2,1H3,(H,22,25)(H,23,29)(H,24,27)/t21-/m1/s1 |
| InChIKey | MYTCQNRSOFMBMZ-OAQYLSRUSA-N |
| XLogP | 0.70 |
| TPSA | 137.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|