C7H13N3O2S — CID 136702205
3-(2-propan-2-yloxyethylsulfanyl)-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 136702205) has the molecular formula C7H13N3O2S and a molecular weight of 203.27 g/mol. Its IUPAC name is 3-(2-propan-2-yloxyethylsulfanyl)-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-(2-propan-2-yloxyethylsulfanyl)-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 136702205 |
| Molecular Formula | C7H13N3O2S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 3-(2-propan-2-yloxyethylsulfanyl)-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | CC(C)OCCSc1n[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C7H13N3O2S/c1-5(2)12-3-4-13-7-8-6(11)9-10-7/h5H,3-4H2,1-2H3,(H2,8,9,10,11) |
| InChIKey | CLIYDUUOFJFYNM-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|