About bis[5-(trinitromethyl)-1H-1,2,4-triazol-3-yl]diazene
bis[5-(trinitromethyl)-1H-1,2,4-triazol-3-yl]diazene (PubChem CID 136703055) has the molecular formula C6H2N14O12
and a molecular weight of 462.17 g/mol. Its IUPAC name is bis[5-(trinitromethyl)-1H-1,2,4-triazol-3-yl]diazene.
Molecular Properties
| Compound Name | bis[5-(trinitromethyl)-1H-1,2,4-triazol-3-yl]diazene |
| PubChem CID | 136703055 |
| Molecular Formula | C6H2N14O12 |
| Molecular Weight | 462.17 g/mol |
| Exact Mass | 462.00 |
| IUPAC Name | bis[5-(trinitromethyl)-1H-1,2,4-triazol-3-yl]diazene |
| SMILES | O=[N+]([O-])C(c1nc(N=Nc2n[nH]c(C([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])n2)n[nH]1)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C6H2N14O12/c21-15(22)5(16(23)24,17(25)26)1-7-3(11-9-1)13-14-4-8-2(10-12-4)6(18(27)28,19(29)30)20(31)32/h(H,7,9,11)(H,8,10,12) |
| InChIKey | WSSLGAOHQSGIMJ-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 366.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.17 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis[5-(trinitromethyl)-1H-1,2,4-triazol-3-yl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[5-(trinitromethyl)-1H-1,2,4-triazol-3-yl]diazene?
The IUPAC name of bis[5-(trinitromethyl)-1H-1,2,4-triazol-3-yl]diazene (CID 136703055) is bis[5-(trinitromethyl)-1H-1,2,4-triazol-3-yl]diazene.
What is the SMILES notation for bis[5-(trinitromethyl)-1H-1,2,4-triazol-3-yl]diazene?
The canonical SMILES for bis[5-(trinitromethyl)-1H-1,2,4-triazol-3-yl]diazene is O=[N+]([O-])C(c1nc(N=Nc2n[nH]c(C([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])n2)n[nH]1)([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of bis[5-(trinitromethyl)-1H-1,2,4-triazol-3-yl]diazene?
The InChIKey is WSSLGAOHQSGIMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2N14O12/c21-15(22)5(16(23)24,17(25)26)1-7-3(11-9-1)13-14-4-8-2(10-12-4)6(18(27)28,19(29)30)20(31)32/h(H,7,9,11)(H,8,10,12).
What are the key properties of bis[5-(trinitromethyl)-1H-1,2,4-triazol-3-yl]diazene?
bis[5-(trinitromethyl)-1H-1,2,4-triazol-3-yl]diazene has a molecular weight of 462.17 g/mol, XLogP of -1.78, 10 rotatable bonds, 2 hydrogen bond donors, and 18 hydrogen bond acceptors.
Where does this data come from?
All data for bis[5-(trinitromethyl)-1H-1,2,4-triazol-3-yl]diazene is sourced from PubChem (CID 136703055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).