C46H33N7O3 — CID 136703111
2-[4-(10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin-5-yl)phenoxy]ethyl prop-2-enoate (PubChem CID 136703111) has the molecular formula C46H33N7O3 and a molecular weight of 731.82 g/mol. Its IUPAC name is 2-[4-(10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin-5-yl)phenoxy]ethyl prop-2-enoate.
| Compound Name | 2-[4-(10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin-5-yl)phenoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 136703111 |
| Molecular Formula | C46H33N7O3 |
| Molecular Weight | 731.82 g/mol |
| Exact Mass | 731.26 |
| IUPAC Name | 2-[4-(10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin-5-yl)phenoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1ccc(-c2c3nc(c(-c4ccncc4)c4ccc([nH]4)c(-c4ccncc4)c4nc(c(-c5ccncc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C46H33N7O3/c1-2-42(54)56-28-27-55-33-5-3-29(4-6-33)43-34-7-9-36(50-34)44(30-15-21-47-22-16-30)38-11-13-40(52-38)46(32-19-25-49-26-20-32)41-14-12-39(53-41)45(31-17-23-48-24-18-31)37-10-8-35(43)51-37/h2-26,50,53H,1,27-28H2/b43-34-,43-35-,44-36-,44-38-,45-37-,45-39-,46-40-,46-41- |
| InChIKey | DZOQLRDDXDFMFI-KQWSROBNSA-N |
| XLogP | 9.62 |
| TPSA | 131.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.82 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|