C20H17ClN2O3S2 — CID 136703213
5-chloro-2-[[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)phenyl]iminomethyl]phenol (PubChem CID 136703213) has the molecular formula C20H17ClN2O3S2 and a molecular weight of 432.95 g/mol. Its IUPAC name is 5-chloro-2-[[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)phenyl]iminomethyl]phenol.
| Compound Name | 5-chloro-2-[[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 136703213 |
| Molecular Formula | C20H17ClN2O3S2 |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | 5-chloro-2-[[4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)phenyl]iminomethyl]phenol |
| SMILES | O=S(=O)(c1ccc(/N=C/c2ccc(Cl)cc2O)cc1)N1CCc2sccc2C1 |
| InChI | InChI=1S/C20H17ClN2O3S2/c21-16-2-1-14(19(24)11-16)12-22-17-3-5-18(6-4-17)28(25,26)23-9-7-20-15(13-23)8-10-27-20/h1-6,8,10-12,24H,7,9,13H2/b22-12+ |
| InChIKey | ZMIZONWLNJPSGP-WSDLNYQXSA-N |
| XLogP | 4.60 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|