About 3,5-difluorocyclohexa-2,4-dien-1-imine
3,5-difluorocyclohexa-2,4-dien-1-imine (PubChem CID 136703987) has the molecular formula C6H4F2N+
and a molecular weight of 128.10 g/mol. Its IUPAC name is 3,5-difluorocyclohexa-2,4-dien-1-imine.
Molecular Properties
| Compound Name | 3,5-difluorocyclohexa-2,4-dien-1-imine |
| PubChem CID | 136703987 |
| Molecular Formula | C6H4F2N+ |
| Molecular Weight | 128.10 g/mol |
| Exact Mass | 128.03 |
| IUPAC Name | 3,5-difluorocyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=C(F)C=C(F)[CH+]1 |
| InChI | InChI=1S/C6H4F2N/c7-4-1-5(8)3-6(9)2-4/h1-3,9H/q+1 |
| InChIKey | ILQFRJNCJSSQMC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.10 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3,5-difluorocyclohexa-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-difluorocyclohexa-2,4-dien-1-imine?
The IUPAC name of 3,5-difluorocyclohexa-2,4-dien-1-imine (CID 136703987) is 3,5-difluorocyclohexa-2,4-dien-1-imine.
What is the SMILES notation for 3,5-difluorocyclohexa-2,4-dien-1-imine?
The canonical SMILES for 3,5-difluorocyclohexa-2,4-dien-1-imine is [H]/N=C1\C=C(F)C=C(F)[CH+]1.
What is the InChIKey of 3,5-difluorocyclohexa-2,4-dien-1-imine?
The InChIKey is ILQFRJNCJSSQMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F2N/c7-4-1-5(8)3-6(9)2-4/h1-3,9H/q+1.
What are the key properties of 3,5-difluorocyclohexa-2,4-dien-1-imine?
3,5-difluorocyclohexa-2,4-dien-1-imine has a molecular weight of 128.10 g/mol, XLogP of 1.93, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-difluorocyclohexa-2,4-dien-1-imine is sourced from PubChem (CID 136703987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).