C11H19ClN4O — CID 136704106
4-[2-(2-aminoethyl)pentylamino]-5-chloro-1H-pyrimidin-6-one (PubChem CID 136704106) has the molecular formula C11H19ClN4O and a molecular weight of 258.75 g/mol. Its IUPAC name is 4-[2-(2-aminoethyl)pentylamino]-5-chloro-1H-pyrimidin-6-one.
| Compound Name | 4-[2-(2-aminoethyl)pentylamino]-5-chloro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136704106 |
| Molecular Formula | C11H19ClN4O |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 4-[2-(2-aminoethyl)pentylamino]-5-chloro-1H-pyrimidin-6-one |
| SMILES | CCCC(CCN)CNc1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C11H19ClN4O/c1-2-3-8(4-5-13)6-14-10-9(12)11(17)16-7-15-10/h7-8H,2-6,13H2,1H3,(H2,14,15,16,17) |
| InChIKey | HLOJWACTPGRSNL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |