C15H18N2O2 — CID 136704890
(4aR,8aS)-4-(2-hydroxy-5-methylphenyl)-4a,5,6,7,8,8a-hexahydro-2H-phthalazin-1-one (PubChem CID 136704890) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is (4aR,8aS)-4-(2-hydroxy-5-methylphenyl)-4a,5,6,7,8,8a-hexahydro-2H-phthalazin-1-one.
| Compound Name | (4aR,8aS)-4-(2-hydroxy-5-methylphenyl)-4a,5,6,7,8,8a-hexahydro-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 136704890 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (4aR,8aS)-4-(2-hydroxy-5-methylphenyl)-4a,5,6,7,8,8a-hexahydro-2H-phthalazin-1-one |
| SMILES | Cc1ccc(O)c(C2=NNC(=O)[C@H]3CCCC[C@@H]23)c1 |
| InChI | InChI=1S/C15H18N2O2/c1-9-6-7-13(18)12(8-9)14-10-4-2-3-5-11(10)15(19)17-16-14/h6-8,10-11,18H,2-5H2,1H3,(H,17,19)/t10-,11+/m1/s1 |
| InChIKey | LWAHYQACONHMBQ-MNOVXSKESA-N |
| XLogP | 2.34 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|