C12H19N5O3 — CID 136705914
2-(3-ethoxycyclobutyl)-N-[4-(N'-hydroxycarbamimidoyl)-1H-pyrazol-5-yl]acetamide (PubChem CID 136705914) has the molecular formula C12H19N5O3 and a molecular weight of 281.32 g/mol. Its IUPAC name is 2-(3-ethoxycyclobutyl)-N-[4-(N'-hydroxycarbamimidoyl)-1H-pyrazol-5-yl]acetamide.
| Compound Name | 2-(3-ethoxycyclobutyl)-N-[4-(N'-hydroxycarbamimidoyl)-1H-pyrazol-5-yl]acetamide |
|---|---|
| PubChem CID | 136705914 |
| Molecular Formula | C12H19N5O3 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 2-(3-ethoxycyclobutyl)-N-[4-(N'-hydroxycarbamimidoyl)-1H-pyrazol-5-yl]acetamide |
| SMILES | CCOC1CC(CC(=O)Nc2[nH]ncc2C(N)=NO)C1 |
| InChI | InChI=1S/C12H19N5O3/c1-2-20-8-3-7(4-8)5-10(18)15-12-9(6-14-16-12)11(13)17-19/h6-8,19H,2-5H2,1H3,(H2,13,17)(H2,14,15,16,18) |
| InChIKey | MAVZOLGUNOANMD-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 125.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|