C30H29N3O5S — CID 136706213
5-(1-hydroxynaphthalen-2-yl)-3-(2-methoxyphenyl)-N-(3,4,5-trimethoxyphenyl)-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 136706213) has the molecular formula C30H29N3O5S and a molecular weight of 543.65 g/mol. Its IUPAC name is 5-(1-hydroxynaphthalen-2-yl)-3-(2-methoxyphenyl)-N-(3,4,5-trimethoxyphenyl)-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | 5-(1-hydroxynaphthalen-2-yl)-3-(2-methoxyphenyl)-N-(3,4,5-trimethoxyphenyl)-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 136706213 |
| Molecular Formula | C30H29N3O5S |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | 5-(1-hydroxynaphthalen-2-yl)-3-(2-methoxyphenyl)-N-(3,4,5-trimethoxyphenyl)-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | COc1ccccc1C1CC(c2ccc3ccccc3c2O)=NN1C(=S)Nc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C30H29N3O5S/c1-35-25-12-8-7-11-22(25)24-17-23(21-14-13-18-9-5-6-10-20(18)28(21)34)32-33(24)30(39)31-19-15-26(36-2)29(38-4)27(16-19)37-3/h5-16,24,34H,17H2,1-4H3,(H,31,39) |
| InChIKey | RJAHTGDPQHZDNV-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|