About 2,6-bis(1,3-benzothiazol-2-yl)phenol
2,6-bis(1,3-benzothiazol-2-yl)phenol (PubChem CID 136706271) has the molecular formula C20H12N2OS2
and a molecular weight of 360.46 g/mol. Its IUPAC name is 2,6-bis(1,3-benzothiazol-2-yl)phenol.
Molecular Properties
| Compound Name | 2,6-bis(1,3-benzothiazol-2-yl)phenol |
| PubChem CID | 136706271 |
| Molecular Formula | C20H12N2OS2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 2,6-bis(1,3-benzothiazol-2-yl)phenol |
| SMILES | Oc1c(-c2nc3ccccc3s2)cccc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H12N2OS2/c23-18-12(19-21-14-8-1-3-10-16(14)24-19)6-5-7-13(18)20-22-15-9-2-4-11-17(15)25-20/h1-11,23H |
| InChIKey | QYQMRQBRXGLQBK-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,6-bis(1,3-benzothiazol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(1,3-benzothiazol-2-yl)phenol?
The IUPAC name of 2,6-bis(1,3-benzothiazol-2-yl)phenol (CID 136706271) is 2,6-bis(1,3-benzothiazol-2-yl)phenol.
What is the SMILES notation for 2,6-bis(1,3-benzothiazol-2-yl)phenol?
The canonical SMILES for 2,6-bis(1,3-benzothiazol-2-yl)phenol is Oc1c(-c2nc3ccccc3s2)cccc1-c1nc2ccccc2s1.
What is the InChIKey of 2,6-bis(1,3-benzothiazol-2-yl)phenol?
The InChIKey is QYQMRQBRXGLQBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12N2OS2/c23-18-12(19-21-14-8-1-3-10-16(14)24-19)6-5-7-13(18)20-22-15-9-2-4-11-17(15)25-20/h1-11,23H.
What are the key properties of 2,6-bis(1,3-benzothiazol-2-yl)phenol?
2,6-bis(1,3-benzothiazol-2-yl)phenol has a molecular weight of 360.46 g/mol, XLogP of 5.95, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(1,3-benzothiazol-2-yl)phenol is sourced from PubChem (CID 136706271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).