About 2-methylimino-5-(1,3-thiazol-5-yl)imidazolidin-4-one
2-methylimino-5-(1,3-thiazol-5-yl)imidazolidin-4-one (PubChem CID 136706809) has the molecular formula C7H8N4OS
and a molecular weight of 196.24 g/mol. Its IUPAC name is 2-methylimino-5-(1,3-thiazol-5-yl)imidazolidin-4-one.
Molecular Properties
| Compound Name | 2-methylimino-5-(1,3-thiazol-5-yl)imidazolidin-4-one |
| PubChem CID | 136706809 |
| Molecular Formula | C7H8N4OS |
| Molecular Weight | 196.24 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 2-methylimino-5-(1,3-thiazol-5-yl)imidazolidin-4-one |
| SMILES | C/N=C1\NC(=O)C(c2cncs2)N1 |
| InChI | InChI=1S/C7H8N4OS/c1-8-7-10-5(6(12)11-7)4-2-9-3-13-4/h2-3,5H,1H3,(H2,8,10,11,12) |
| InChIKey | BPHXSNIQPPTOPM-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.24 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylimino-5-(1,3-thiazol-5-yl)imidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylimino-5-(1,3-thiazol-5-yl)imidazolidin-4-one?
The IUPAC name of 2-methylimino-5-(1,3-thiazol-5-yl)imidazolidin-4-one (CID 136706809) is 2-methylimino-5-(1,3-thiazol-5-yl)imidazolidin-4-one.
What is the SMILES notation for 2-methylimino-5-(1,3-thiazol-5-yl)imidazolidin-4-one?
The canonical SMILES for 2-methylimino-5-(1,3-thiazol-5-yl)imidazolidin-4-one is C/N=C1\NC(=O)C(c2cncs2)N1.
What is the InChIKey of 2-methylimino-5-(1,3-thiazol-5-yl)imidazolidin-4-one?
The InChIKey is BPHXSNIQPPTOPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4OS/c1-8-7-10-5(6(12)11-7)4-2-9-3-13-4/h2-3,5H,1H3,(H2,8,10,11,12).
What are the key properties of 2-methylimino-5-(1,3-thiazol-5-yl)imidazolidin-4-one?
2-methylimino-5-(1,3-thiazol-5-yl)imidazolidin-4-one has a molecular weight of 196.24 g/mol, XLogP of -0.11, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylimino-5-(1,3-thiazol-5-yl)imidazolidin-4-one is sourced from PubChem (CID 136706809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).