C17H29N3O3 — CID 136706823
2-tert-butyl-N-[(2S)-3-ethyl-2-hydroxypentyl]-4-methyl-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 136706823) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-tert-butyl-N-[(2S)-3-ethyl-2-hydroxypentyl]-4-methyl-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | 2-tert-butyl-N-[(2S)-3-ethyl-2-hydroxypentyl]-4-methyl-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136706823 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 2-tert-butyl-N-[(2S)-3-ethyl-2-hydroxypentyl]-4-methyl-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | CCC(CC)[C@H](O)CNC(=O)c1c(C)nc(C(C)(C)C)[nH]c1=O |
| InChI | InChI=1S/C17H29N3O3/c1-7-11(8-2)12(21)9-18-14(22)13-10(3)19-16(17(4,5)6)20-15(13)23/h11-12,21H,7-9H2,1-6H3,(H,18,22)(H,19,20,23)/t12-/m1/s1 |
| InChIKey | RVUNEIWSRXQRMI-GFCCVEGCSA-N |
| XLogP | 1.90 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |