C16H10F2N2O2 — CID 136707513
5,6-difluoro-2,3-dihydronaphtho[3,2-f]quinoxaline-7,12-diol (PubChem CID 136707513) has the molecular formula C16H10F2N2O2 and a molecular weight of 300.26 g/mol. Its IUPAC name is 5,6-difluoro-2,3-dihydronaphtho[3,2-f]quinoxaline-7,12-diol.
| Compound Name | 5,6-difluoro-2,3-dihydronaphtho[3,2-f]quinoxaline-7,12-diol |
|---|---|
| PubChem CID | 136707513 |
| Molecular Formula | C16H10F2N2O2 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 5,6-difluoro-2,3-dihydronaphtho[3,2-f]quinoxaline-7,12-diol |
| SMILES | Oc1c2ccccc2c(O)c2c3c(c(F)c(F)c12)=NCCN=3 |
| InChI | InChI=1S/C16H10F2N2O2/c17-11-9-10(13-14(12(11)18)20-6-5-19-13)16(22)8-4-2-1-3-7(8)15(9)21/h1-4,21-22H,5-6H2 |
| InChIKey | XWEINBSBVCIRFV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|