C18H14F2N2O2 — CID 136707514
10,11-difluoro-3,8-diazatetracyclo[10.8.0.02,9.014,19]icosa-1(20),2,8,10,12,14,16,18-octaene-13,20-diol (PubChem CID 136707514) has the molecular formula C18H14F2N2O2 and a molecular weight of 328.32 g/mol. Its IUPAC name is 10,11-difluoro-3,8-diazatetracyclo[10.8.0.02,9.014,19]icosa-1(20),2,8,10,12,14,16,18-octaene-13,20-diol.
| Compound Name | 10,11-difluoro-3,8-diazatetracyclo[10.8.0.02,9.014,19]icosa-1(20),2,8,10,12,14,16,18-octaene-13,20-diol |
|---|---|
| PubChem CID | 136707514 |
| Molecular Formula | C18H14F2N2O2 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 10,11-difluoro-3,8-diazatetracyclo[10.8.0.02,9.014,19]icosa-1(20),2,8,10,12,14,16,18-octaene-13,20-diol |
| SMILES | Oc1c2ccccc2c(O)c2c3/c(c(F)c(F)c12)=N\CCCC/N=3 |
| InChI | InChI=1S/C18H14F2N2O2/c19-13-11-12(15-16(14(13)20)22-8-4-3-7-21-15)18(24)10-6-2-1-5-9(10)17(11)23/h1-2,5-6,23-24H,3-4,7-8H2/b21-15-,22-16- |
| InChIKey | GXNKIJARKLZUIP-BMJUYKDLSA-N |
| XLogP | 2.72 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|