C17H17N3O3 — CID 136707660
(2S)-16-ethyl-17-hydroxy-6,14,18-triazatetracyclo[12.4.0.02,6.08,13]octadeca-1(18),8,10,12,16-pentaene-7,15-dione (PubChem CID 136707660) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is (2S)-16-ethyl-17-hydroxy-6,14,18-triazatetracyclo[12.4.0.02,6.08,13]octadeca-1(18),8,10,12,16-pentaene-7,15-dione.
| Compound Name | (2S)-16-ethyl-17-hydroxy-6,14,18-triazatetracyclo[12.4.0.02,6.08,13]octadeca-1(18),8,10,12,16-pentaene-7,15-dione |
|---|---|
| PubChem CID | 136707660 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (2S)-16-ethyl-17-hydroxy-6,14,18-triazatetracyclo[12.4.0.02,6.08,13]octadeca-1(18),8,10,12,16-pentaene-7,15-dione |
| SMILES | CCc1c(O)nc2n(c1=O)-c1ccccc1C(=O)N1CCC[C@@H]21 |
| InChI | InChI=1S/C17H17N3O3/c1-2-10-15(21)18-14-13-8-5-9-19(13)16(22)11-6-3-4-7-12(11)20(14)17(10)23/h3-4,6-7,13,21H,2,5,8-9H2,1H3/t13-/m0/s1 |
| InChIKey | STNOLRBAFUMYHA-ZDUSSCGKSA-N |
| XLogP | 1.79 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |