C20H23N4O4S+ — CID 136707776
2-[4-[(4-hydroxy-2-oxo-1H-quinolin-3-yl)diazenyl]phenyl]sulfonylethyl-trimethylazanium (PubChem CID 136707776) has the molecular formula C20H23N4O4S+ and a molecular weight of 415.50 g/mol. Its IUPAC name is 2-[4-[(4-hydroxy-2-oxo-1H-quinolin-3-yl)diazenyl]phenyl]sulfonylethyl-trimethylazanium.
| Compound Name | 2-[4-[(4-hydroxy-2-oxo-1H-quinolin-3-yl)diazenyl]phenyl]sulfonylethyl-trimethylazanium |
|---|---|
| PubChem CID | 136707776 |
| Molecular Formula | C20H23N4O4S+ |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 2-[4-[(4-hydroxy-2-oxo-1H-quinolin-3-yl)diazenyl]phenyl]sulfonylethyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCS(=O)(=O)c1ccc(/N=N/c2c(O)c3ccccc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C20H22N4O4S/c1-24(2,3)12-13-29(27,28)15-10-8-14(9-11-15)22-23-18-19(25)16-6-4-5-7-17(16)21-20(18)26/h4-11H,12-13H2,1-3H3,(H-,21,22,25,26)/p+1 |
| InChIKey | WEMPUXYTOWQULY-UHFFFAOYSA-O |
| XLogP | 3.13 |
| TPSA | 111.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|