C25H20ClN3O6S — CID 136707852
5-chloro-3-[[2-hydroxy-3-[(2-methoxyphenyl)carbamoyl]naphthalen-1-yl]diazenyl]-2-methylbenzenesulfonic acid (PubChem CID 136707852) has the molecular formula C25H20ClN3O6S and a molecular weight of 525.97 g/mol. Its IUPAC name is 5-chloro-3-[[2-hydroxy-3-[(2-methoxyphenyl)carbamoyl]naphthalen-1-yl]diazenyl]-2-methylbenzenesulfonic acid.
| Compound Name | 5-chloro-3-[[2-hydroxy-3-[(2-methoxyphenyl)carbamoyl]naphthalen-1-yl]diazenyl]-2-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 136707852 |
| Molecular Formula | C25H20ClN3O6S |
| Molecular Weight | 525.97 g/mol |
| Exact Mass | 525.08 |
| IUPAC Name | 5-chloro-3-[[2-hydroxy-3-[(2-methoxyphenyl)carbamoyl]naphthalen-1-yl]diazenyl]-2-methylbenzenesulfonic acid |
| SMILES | COc1ccccc1NC(=O)c1cc2ccccc2c(/N=N/c2cc(Cl)cc(S(=O)(=O)O)c2C)c1O |
| InChI | InChI=1S/C25H20ClN3O6S/c1-14-20(12-16(26)13-22(14)36(32,33)34)28-29-23-17-8-4-3-7-15(17)11-18(24(23)30)25(31)27-19-9-5-6-10-21(19)35-2/h3-13,30H,1-2H3,(H,27,31)(H,32,33,34)/b29-28+ |
| InChIKey | HXZVTCQULDJNBZ-ZQHSETAFSA-N |
| XLogP | 6.43 |
| TPSA | 137.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.97 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|