About 2-[2-[(2,4-dihydroxyphenyl)methylideneamino]phenoxy]benzonitrile
2-[2-[(2,4-dihydroxyphenyl)methylideneamino]phenoxy]benzonitrile (PubChem CID 136711049) has the molecular formula C20H14N2O3
and a molecular weight of 330.34 g/mol. Its IUPAC name is 2-[2-[(2,4-dihydroxyphenyl)methylideneamino]phenoxy]benzonitrile.
Molecular Properties
| Compound Name | 2-[2-[(2,4-dihydroxyphenyl)methylideneamino]phenoxy]benzonitrile |
| PubChem CID | 136711049 |
| Molecular Formula | C20H14N2O3 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-[2-[(2,4-dihydroxyphenyl)methylideneamino]phenoxy]benzonitrile |
| SMILES | N#Cc1ccccc1Oc1ccccc1/N=C/c1ccc(O)cc1O |
| InChI | InChI=1S/C20H14N2O3/c21-12-14-5-1-3-7-19(14)25-20-8-4-2-6-17(20)22-13-15-9-10-16(23)11-18(15)24/h1-11,13,23-24H/b22-13+ |
| InChIKey | ORXGGBOVVATQQH-LPYMAVHISA-N |
| XLogP | 4.51 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(2,4-dihydroxyphenyl)methylideneamino]phenoxy]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(2,4-dihydroxyphenyl)methylideneamino]phenoxy]benzonitrile?
The IUPAC name of 2-[2-[(2,4-dihydroxyphenyl)methylideneamino]phenoxy]benzonitrile (CID 136711049) is 2-[2-[(2,4-dihydroxyphenyl)methylideneamino]phenoxy]benzonitrile.
What is the SMILES notation for 2-[2-[(2,4-dihydroxyphenyl)methylideneamino]phenoxy]benzonitrile?
The canonical SMILES for 2-[2-[(2,4-dihydroxyphenyl)methylideneamino]phenoxy]benzonitrile is N#Cc1ccccc1Oc1ccccc1/N=C/c1ccc(O)cc1O.
What is the InChIKey of 2-[2-[(2,4-dihydroxyphenyl)methylideneamino]phenoxy]benzonitrile?
The InChIKey is ORXGGBOVVATQQH-LPYMAVHISA-N. The full InChI is InChI=1S/C20H14N2O3/c21-12-14-5-1-3-7-19(14)25-20-8-4-2-6-17(20)22-13-15-9-10-16(23)11-18(15)24/h1-11,13,23-24H/b22-13+.
What are the key properties of 2-[2-[(2,4-dihydroxyphenyl)methylideneamino]phenoxy]benzonitrile?
2-[2-[(2,4-dihydroxyphenyl)methylideneamino]phenoxy]benzonitrile has a molecular weight of 330.34 g/mol, XLogP of 4.51, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(2,4-dihydroxyphenyl)methylideneamino]phenoxy]benzonitrile is sourced from PubChem (CID 136711049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).