C11H12Cl2FN3 — CID 136711504
4-[(2-chloro-6-fluorophenyl)methyl]-5-methyl-1H-pyrazol-2-ium-3-amine chloride (PubChem CID 136711504) has the molecular formula C11H12Cl2FN3 and a molecular weight of 276.14 g/mol. Its IUPAC name is 4-[(2-chloro-6-fluorophenyl)methyl]-5-methyl-1H-pyrazol-2-ium-3-amine chloride.
| Compound Name | 4-[(2-chloro-6-fluorophenyl)methyl]-5-methyl-1H-pyrazol-2-ium-3-amine chloride |
|---|---|
| PubChem CID | 136711504 |
| Molecular Formula | C11H12Cl2FN3 |
| Molecular Weight | 276.14 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 4-[(2-chloro-6-fluorophenyl)methyl]-5-methyl-1H-pyrazol-2-ium-3-amine chloride |
| SMILES | Cc1[nH][nH+]c(N)c1Cc1c(F)cccc1Cl.[Cl-] |
| InChI | InChI=1S/C11H11ClFN3.ClH/c1-6-7(11(14)16-15-6)5-8-9(12)3-2-4-10(8)13;/h2-4H,5H2,1H3,(H3,14,15,16);1H |
| InChIKey | TVSGULJQRHXNPN-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 55.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.14 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |