About 4-[N-[(2,6-difluorophenyl)methyl]-C-methylcarbonimidoyl]-3-hydroxy-1,2-dihydropyrrol-5-one
4-[N-[(2,6-difluorophenyl)methyl]-C-methylcarbonimidoyl]-3-hydroxy-1,2-dihydropyrrol-5-one (PubChem CID 136711555) has the molecular formula C13H12F2N2O2
and a molecular weight of 266.25 g/mol. Its IUPAC name is 4-[N-[(2,6-difluorophenyl)methyl]-C-methylcarbonimidoyl]-3-hydroxy-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | 4-[N-[(2,6-difluorophenyl)methyl]-C-methylcarbonimidoyl]-3-hydroxy-1,2-dihydropyrrol-5-one |
| PubChem CID | 136711555 |
| Molecular Formula | C13H12F2N2O2 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 4-[N-[(2,6-difluorophenyl)methyl]-C-methylcarbonimidoyl]-3-hydroxy-1,2-dihydropyrrol-5-one |
| SMILES | C/C(=N\Cc1c(F)cccc1F)C1=C(O)CNC1=O |
| InChI | InChI=1S/C13H12F2N2O2/c1-7(12-11(18)6-17-13(12)19)16-5-8-9(14)3-2-4-10(8)15/h2-4,18H,5-6H2,1H3,(H,17,19)/b16-7+ |
| InChIKey | ILNMUHDHCXFKMH-FRKPEAEDSA-N |
| XLogP | 1.87 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[N-[(2,6-difluorophenyl)methyl]-C-methylcarbonimidoyl]-3-hydroxy-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[N-[(2,6-difluorophenyl)methyl]-C-methylcarbonimidoyl]-3-hydroxy-1,2-dihydropyrrol-5-one?
The IUPAC name of 4-[N-[(2,6-difluorophenyl)methyl]-C-methylcarbonimidoyl]-3-hydroxy-1,2-dihydropyrrol-5-one (CID 136711555) is 4-[N-[(2,6-difluorophenyl)methyl]-C-methylcarbonimidoyl]-3-hydroxy-1,2-dihydropyrrol-5-one.
What is the SMILES notation for 4-[N-[(2,6-difluorophenyl)methyl]-C-methylcarbonimidoyl]-3-hydroxy-1,2-dihydropyrrol-5-one?
The canonical SMILES for 4-[N-[(2,6-difluorophenyl)methyl]-C-methylcarbonimidoyl]-3-hydroxy-1,2-dihydropyrrol-5-one is C/C(=N\Cc1c(F)cccc1F)C1=C(O)CNC1=O.
What is the InChIKey of 4-[N-[(2,6-difluorophenyl)methyl]-C-methylcarbonimidoyl]-3-hydroxy-1,2-dihydropyrrol-5-one?
The InChIKey is ILNMUHDHCXFKMH-FRKPEAEDSA-N. The full InChI is InChI=1S/C13H12F2N2O2/c1-7(12-11(18)6-17-13(12)19)16-5-8-9(14)3-2-4-10(8)15/h2-4,18H,5-6H2,1H3,(H,17,19)/b16-7+.
What are the key properties of 4-[N-[(2,6-difluorophenyl)methyl]-C-methylcarbonimidoyl]-3-hydroxy-1,2-dihydropyrrol-5-one?
4-[N-[(2,6-difluorophenyl)methyl]-C-methylcarbonimidoyl]-3-hydroxy-1,2-dihydropyrrol-5-one has a molecular weight of 266.25 g/mol, XLogP of 1.87, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[N-[(2,6-difluorophenyl)methyl]-C-methylcarbonimidoyl]-3-hydroxy-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 136711555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).