About 4-[(2-chlorophenyl)methyliminomethyl]-3-hydroxy-1,2-dihydropyrrol-5-one
4-[(2-chlorophenyl)methyliminomethyl]-3-hydroxy-1,2-dihydropyrrol-5-one (PubChem CID 136711594) has the molecular formula C12H11ClN2O2
and a molecular weight of 250.69 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methyliminomethyl]-3-hydroxy-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | 4-[(2-chlorophenyl)methyliminomethyl]-3-hydroxy-1,2-dihydropyrrol-5-one |
| PubChem CID | 136711594 |
| Molecular Formula | C12H11ClN2O2 |
| Molecular Weight | 250.69 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 4-[(2-chlorophenyl)methyliminomethyl]-3-hydroxy-1,2-dihydropyrrol-5-one |
| SMILES | O=C1NCC(O)=C1/C=N/Cc1ccccc1Cl |
| InChI | InChI=1S/C12H11ClN2O2/c13-10-4-2-1-3-8(10)5-14-6-9-11(16)7-15-12(9)17/h1-4,6,16H,5,7H2,(H,15,17)/b14-6+ |
| InChIKey | FHGKGPBAXJRIJU-MKMNVTDBSA-N |
| XLogP | 1.85 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.69 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2-chlorophenyl)methyliminomethyl]-3-hydroxy-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-chlorophenyl)methyliminomethyl]-3-hydroxy-1,2-dihydropyrrol-5-one?
The IUPAC name of 4-[(2-chlorophenyl)methyliminomethyl]-3-hydroxy-1,2-dihydropyrrol-5-one (CID 136711594) is 4-[(2-chlorophenyl)methyliminomethyl]-3-hydroxy-1,2-dihydropyrrol-5-one.
What is the SMILES notation for 4-[(2-chlorophenyl)methyliminomethyl]-3-hydroxy-1,2-dihydropyrrol-5-one?
The canonical SMILES for 4-[(2-chlorophenyl)methyliminomethyl]-3-hydroxy-1,2-dihydropyrrol-5-one is O=C1NCC(O)=C1/C=N/Cc1ccccc1Cl.
What is the InChIKey of 4-[(2-chlorophenyl)methyliminomethyl]-3-hydroxy-1,2-dihydropyrrol-5-one?
The InChIKey is FHGKGPBAXJRIJU-MKMNVTDBSA-N. The full InChI is InChI=1S/C12H11ClN2O2/c13-10-4-2-1-3-8(10)5-14-6-9-11(16)7-15-12(9)17/h1-4,6,16H,5,7H2,(H,15,17)/b14-6+.
What are the key properties of 4-[(2-chlorophenyl)methyliminomethyl]-3-hydroxy-1,2-dihydropyrrol-5-one?
4-[(2-chlorophenyl)methyliminomethyl]-3-hydroxy-1,2-dihydropyrrol-5-one has a molecular weight of 250.69 g/mol, XLogP of 1.85, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-chlorophenyl)methyliminomethyl]-3-hydroxy-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 136711594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).