C9H9N5O4 — CID 136711683
6-[(E)-hydroxyiminomethyl]-1,3-dimethyl-8H-pteridine-2,4,7-trione (PubChem CID 136711683) has the molecular formula C9H9N5O4 and a molecular weight of 251.20 g/mol. Its IUPAC name is 6-[(E)-hydroxyiminomethyl]-1,3-dimethyl-8H-pteridine-2,4,7-trione.
| Compound Name | 6-[(E)-hydroxyiminomethyl]-1,3-dimethyl-8H-pteridine-2,4,7-trione |
|---|---|
| PubChem CID | 136711683 |
| Molecular Formula | C9H9N5O4 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 6-[(E)-hydroxyiminomethyl]-1,3-dimethyl-8H-pteridine-2,4,7-trione |
| SMILES | Cn1c(=O)c2nc(/C=N/O)c(=O)[nH]c2n(C)c1=O |
| InChI | InChI=1S/C9H9N5O4/c1-13-6-5(8(16)14(2)9(13)17)11-4(3-10-18)7(15)12-6/h3,18H,1-2H3,(H,12,15)/b10-3+ |
| InChIKey | QSTATZFXWUCYMW-XCVCLJGOSA-N |
| XLogP | -1.87 |
| TPSA | 122.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|