C15H12Cl2N2O4 — CID 136712147
N-[(E)-(3,5-dichloro-2,4-dihydroxyphenyl)methylideneamino]-2-methoxybenzamide (PubChem CID 136712147) has the molecular formula C15H12Cl2N2O4 and a molecular weight of 355.18 g/mol. Its IUPAC name is N-[(E)-(3,5-dichloro-2,4-dihydroxyphenyl)methylideneamino]-2-methoxybenzamide.
| Compound Name | N-[(E)-(3,5-dichloro-2,4-dihydroxyphenyl)methylideneamino]-2-methoxybenzamide |
|---|---|
| PubChem CID | 136712147 |
| Molecular Formula | C15H12Cl2N2O4 |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | N-[(E)-(3,5-dichloro-2,4-dihydroxyphenyl)methylideneamino]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)N/N=C/c1cc(Cl)c(O)c(Cl)c1O |
| InChI | InChI=1S/C15H12Cl2N2O4/c1-23-11-5-3-2-4-9(11)15(22)19-18-7-8-6-10(16)14(21)12(17)13(8)20/h2-7,20-21H,1H3,(H,19,22)/b18-7+ |
| InChIKey | OHJMAPWHXRUYCK-CNHKJKLMSA-N |
| XLogP | 3.18 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|