C13H13N5O — CID 136712641
2-amino-6-(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)phenol (PubChem CID 136712641) has the molecular formula C13H13N5O and a molecular weight of 255.28 g/mol. Its IUPAC name is 2-amino-6-(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)phenol.
| Compound Name | 2-amino-6-(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)phenol |
|---|---|
| PubChem CID | 136712641 |
| Molecular Formula | C13H13N5O |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2-amino-6-(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)phenol |
| SMILES | Cc1cc(C)n2c(-c3cccc(N)c3O)nnc2n1 |
| InChI | InChI=1S/C13H13N5O/c1-7-6-8(2)18-12(16-17-13(18)15-7)9-4-3-5-10(14)11(9)19/h3-6,19H,14H2,1-2H3 |
| InChIKey | SHVBSBFGHYLDLW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|