C29H27FN6O3 — CID 136713177
N-[(Z)-1-[4-(dimethylamino)phenyl]-3-[(2Z)-2-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]-3-fluorobenzamide (PubChem CID 136713177) has the molecular formula C29H27FN6O3 and a molecular weight of 526.57 g/mol. Its IUPAC name is N-[(Z)-1-[4-(dimethylamino)phenyl]-3-[(2Z)-2-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]-3-fluorobenzamide.
| Compound Name | N-[(Z)-1-[4-(dimethylamino)phenyl]-3-[(2Z)-2-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 136713177 |
| Molecular Formula | C29H27FN6O3 |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | N-[(Z)-1-[4-(dimethylamino)phenyl]-3-[(2Z)-2-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]-3-fluorobenzamide |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=O)c1/C=N\NC(=O)/C(=C/c1ccc(N(C)C)cc1)NC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C29H27FN6O3/c1-19-25(29(39)36(34-19)24-10-5-4-6-11-24)18-31-33-28(38)26(16-20-12-14-23(15-13-20)35(2)3)32-27(37)21-8-7-9-22(30)17-21/h4-18,34H,1-3H3,(H,32,37)(H,33,38)/b26-16-,31-18- |
| InChIKey | GVOZETZLQMNINC-LFPUEGMISA-N |
| XLogP | 3.60 |
| TPSA | 111.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|