About N-tert-butyl-3-[(4,5-dioxoimidazolidin-2-ylidene)amino]propanamide
N-tert-butyl-3-[(4,5-dioxoimidazolidin-2-ylidene)amino]propanamide (PubChem CID 136713428) has the molecular formula C10H16N4O3
and a molecular weight of 240.26 g/mol. Its IUPAC name is N-tert-butyl-3-[(4,5-dioxoimidazolidin-2-ylidene)amino]propanamide.
Molecular Properties
| Compound Name | N-tert-butyl-3-[(4,5-dioxoimidazolidin-2-ylidene)amino]propanamide |
| PubChem CID | 136713428 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | N-tert-butyl-3-[(4,5-dioxoimidazolidin-2-ylidene)amino]propanamide |
| SMILES | CC(C)(C)NC(=O)CCN=C1NC(=O)C(=O)N1 |
| InChI | InChI=1S/C10H16N4O3/c1-10(2,3)14-6(15)4-5-11-9-12-7(16)8(17)13-9/h4-5H2,1-3H3,(H,14,15)(H2,11,12,13,16,17) |
| InChIKey | GFSIFKBEYNYKGG-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-3-[(4,5-dioxoimidazolidin-2-ylidene)amino]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-3-[(4,5-dioxoimidazolidin-2-ylidene)amino]propanamide?
The IUPAC name of N-tert-butyl-3-[(4,5-dioxoimidazolidin-2-ylidene)amino]propanamide (CID 136713428) is N-tert-butyl-3-[(4,5-dioxoimidazolidin-2-ylidene)amino]propanamide.
What is the SMILES notation for N-tert-butyl-3-[(4,5-dioxoimidazolidin-2-ylidene)amino]propanamide?
The canonical SMILES for N-tert-butyl-3-[(4,5-dioxoimidazolidin-2-ylidene)amino]propanamide is CC(C)(C)NC(=O)CCN=C1NC(=O)C(=O)N1.
What is the InChIKey of N-tert-butyl-3-[(4,5-dioxoimidazolidin-2-ylidene)amino]propanamide?
The InChIKey is GFSIFKBEYNYKGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O3/c1-10(2,3)14-6(15)4-5-11-9-12-7(16)8(17)13-9/h4-5H2,1-3H3,(H,14,15)(H2,11,12,13,16,17).
What are the key properties of N-tert-butyl-3-[(4,5-dioxoimidazolidin-2-ylidene)amino]propanamide?
N-tert-butyl-3-[(4,5-dioxoimidazolidin-2-ylidene)amino]propanamide has a molecular weight of 240.26 g/mol, XLogP of -1.11, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-3-[(4,5-dioxoimidazolidin-2-ylidene)amino]propanamide is sourced from PubChem (CID 136713428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).