About 2-cyclopropyl-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one
2-cyclopropyl-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one (PubChem CID 136713915) has the molecular formula C11H17N3O3
and a molecular weight of 239.27 g/mol. Its IUPAC name is 2-cyclopropyl-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-cyclopropyl-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one |
| PubChem CID | 136713915 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 2-cyclopropyl-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one |
| SMILES | COC(CNc1cc(=O)[nH]c(C2CC2)n1)OC |
| InChI | InChI=1S/C11H17N3O3/c1-16-10(17-2)6-12-8-5-9(15)14-11(13-8)7-3-4-7/h5,7,10H,3-4,6H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | HUFNEVAWPKWNNS-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopropyl-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one?
The IUPAC name of 2-cyclopropyl-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one (CID 136713915) is 2-cyclopropyl-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one.
What is the SMILES notation for 2-cyclopropyl-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one?
The canonical SMILES for 2-cyclopropyl-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one is COC(CNc1cc(=O)[nH]c(C2CC2)n1)OC.
What is the InChIKey of 2-cyclopropyl-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one?
The InChIKey is HUFNEVAWPKWNNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O3/c1-16-10(17-2)6-12-8-5-9(15)14-11(13-8)7-3-4-7/h5,7,10H,3-4,6H2,1-2H3,(H2,12,13,14,15).
What are the key properties of 2-cyclopropyl-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one?
2-cyclopropyl-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one has a molecular weight of 239.27 g/mol, XLogP of 0.68, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-4-(2,2-dimethoxyethylamino)-1H-pyrimidin-6-one is sourced from PubChem (CID 136713915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).