C17H24N6O2 — CID 136714184
3-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)-N-[(6R)-3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]propanamide (PubChem CID 136714184) has the molecular formula C17H24N6O2 and a molecular weight of 344.42 g/mol. Its IUPAC name is 3-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)-N-[(6R)-3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]propanamide.
| Compound Name | 3-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)-N-[(6R)-3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]propanamide |
|---|---|
| PubChem CID | 136714184 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 3-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)-N-[(6R)-3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]propanamide |
| SMILES | CCc1nnc2n1C[C@H](NC(=O)CCc1c(C)nc(C)[nH]c1=O)CC2 |
| InChI | InChI=1S/C17H24N6O2/c1-4-14-21-22-15-7-5-12(9-23(14)15)20-16(24)8-6-13-10(2)18-11(3)19-17(13)25/h12H,4-9H2,1-3H3,(H,20,24)(H,18,19,25)/t12-/m1/s1 |
| InChIKey | XVSRDFKZWKXRAC-GFCCVEGCSA-N |
| XLogP | 0.60 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |