About 2-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]phenol
2-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]phenol (PubChem CID 136715086) has the molecular formula C21H20N2OS2
and a molecular weight of 380.54 g/mol. Its IUPAC name is 2-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]phenol.
Molecular Properties
| Compound Name | 2-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]phenol |
| PubChem CID | 136715086 |
| Molecular Formula | C21H20N2OS2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 2-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]phenol |
| SMILES | Cc1cc(-c2nc(-c3ccccc3O)[nH]c2-c2cc(C)sc2C)c(C)s1 |
| InChI | InChI=1S/C21H20N2OS2/c1-11-9-16(13(3)25-11)19-20(17-10-12(2)26-14(17)4)23-21(22-19)15-7-5-6-8-18(15)24/h5-10,24H,1-4H3,(H,22,23) |
| InChIKey | LEWCUUWWWPGKEU-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]phenol?
The IUPAC name of 2-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]phenol (CID 136715086) is 2-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]phenol.
What is the SMILES notation for 2-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]phenol?
The canonical SMILES for 2-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]phenol is Cc1cc(-c2nc(-c3ccccc3O)[nH]c2-c2cc(C)sc2C)c(C)s1.
What is the InChIKey of 2-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]phenol?
The InChIKey is LEWCUUWWWPGKEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2OS2/c1-11-9-16(13(3)25-11)19-20(17-10-12(2)26-14(17)4)23-21(22-19)15-7-5-6-8-18(15)24/h5-10,24H,1-4H3,(H,22,23).
What are the key properties of 2-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]phenol?
2-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]phenol has a molecular weight of 380.54 g/mol, XLogP of 6.47, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazol-2-yl]phenol is sourced from PubChem (CID 136715086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).