C17H25N5O3 — CID 136715636
4-[1-[(2R)-4-acetylpiperazine-2-carbonyl]piperidin-4-yl]-2-methyl-1H-pyrimidin-6-one (PubChem CID 136715636) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is 4-[1-[(2R)-4-acetylpiperazine-2-carbonyl]piperidin-4-yl]-2-methyl-1H-pyrimidin-6-one.
| Compound Name | 4-[1-[(2R)-4-acetylpiperazine-2-carbonyl]piperidin-4-yl]-2-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136715636 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 4-[1-[(2R)-4-acetylpiperazine-2-carbonyl]piperidin-4-yl]-2-methyl-1H-pyrimidin-6-one |
| SMILES | CC(=O)N1CCN[C@@H](C(=O)N2CCC(c3cc(=O)[nH]c(C)n3)CC2)C1 |
| InChI | InChI=1S/C17H25N5O3/c1-11-19-14(9-16(24)20-11)13-3-6-21(7-4-13)17(25)15-10-22(12(2)23)8-5-18-15/h9,13,15,18H,3-8,10H2,1-2H3,(H,19,20,24)/t15-/m1/s1 |
| InChIKey | UFJUPQMNJCRBIA-OAHLLOKOSA-N |
| XLogP | -0.40 |
| TPSA | 98.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |