C16H19N5O4 — CID 136716172
(2R)-2-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)hydrazinyl]-2-(3,4,5-trimethoxyphenyl)acetonitrile (PubChem CID 136716172) has the molecular formula C16H19N5O4 and a molecular weight of 345.36 g/mol. Its IUPAC name is (2R)-2-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)hydrazinyl]-2-(3,4,5-trimethoxyphenyl)acetonitrile.
| Compound Name | (2R)-2-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)hydrazinyl]-2-(3,4,5-trimethoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 136716172 |
| Molecular Formula | C16H19N5O4 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | (2R)-2-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)hydrazinyl]-2-(3,4,5-trimethoxyphenyl)acetonitrile |
| SMILES | COc1cc([C@H](C#N)NNc2nc(C)cc(=O)[nH]2)cc(OC)c1OC |
| InChI | InChI=1S/C16H19N5O4/c1-9-5-14(22)19-16(18-9)21-20-11(8-17)10-6-12(23-2)15(25-4)13(7-10)24-3/h5-7,11,20H,1-4H3,(H2,18,19,21,22)/t11-/m0/s1 |
| InChIKey | WGFRPDJDLIBSHF-NSHDSACASA-N |
| XLogP | 1.29 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|