C14H16N4O6 — CID 136717412
2,4-diamino-5-(2-hydroxy-3,4,5-trimethoxybenzoyl)-1H-pyrimidin-6-one (PubChem CID 136717412) has the molecular formula C14H16N4O6 and a molecular weight of 336.30 g/mol. Its IUPAC name is 2,4-diamino-5-(2-hydroxy-3,4,5-trimethoxybenzoyl)-1H-pyrimidin-6-one.
| Compound Name | 2,4-diamino-5-(2-hydroxy-3,4,5-trimethoxybenzoyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136717412 |
| Molecular Formula | C14H16N4O6 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2,4-diamino-5-(2-hydroxy-3,4,5-trimethoxybenzoyl)-1H-pyrimidin-6-one |
| SMILES | COc1cc(C(=O)c2c(N)nc(N)[nH]c2=O)c(O)c(OC)c1OC |
| InChI | InChI=1S/C14H16N4O6/c1-22-6-4-5(9(20)11(24-3)10(6)23-2)8(19)7-12(15)17-14(16)18-13(7)21/h4,20H,1-3H3,(H5,15,16,17,18,21) |
| InChIKey | FZJSHVIZZYEMML-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 162.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |