C22H22F3N5O2 — CID 136718154
[(5R,7R)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]-[(2R)-2-pyridin-3-ylpiperidin-1-yl]methanone (PubChem CID 136718154) has the molecular formula C22H22F3N5O2 and a molecular weight of 445.45 g/mol. Its IUPAC name is [(5R,7R)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]-[(2R)-2-pyridin-3-ylpiperidin-1-yl]methanone.
| Compound Name | [(5R,7R)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]-[(2R)-2-pyridin-3-ylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 136718154 |
| Molecular Formula | C22H22F3N5O2 |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | [(5R,7R)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-3-yl]-[(2R)-2-pyridin-3-ylpiperidin-1-yl]methanone |
| SMILES | O=C(c1cnn2c1N[C@@H](c1ccco1)C[C@@H]2C(F)(F)F)N1CCCC[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C22H22F3N5O2/c23-22(24,25)19-11-16(18-7-4-10-32-18)28-20-15(13-27-30(19)20)21(31)29-9-2-1-6-17(29)14-5-3-8-26-12-14/h3-5,7-8,10,12-13,16-17,19,28H,1-2,6,9,11H2/t16-,17-,19-/m1/s1 |
| InChIKey | IRPULAJQASJBJI-ZHALLVOQSA-N |
| XLogP | 4.90 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |