C27H22ClN3O3 — CID 136718230
6-chloro-3-[(3R)-3-(2-hydroxyphenyl)-2-propanoyl-3,4-dihydropyrazol-5-yl]-4-phenyl-1H-quinolin-2-one (PubChem CID 136718230) has the molecular formula C27H22ClN3O3 and a molecular weight of 471.94 g/mol. Its IUPAC name is 6-chloro-3-[(3R)-3-(2-hydroxyphenyl)-2-propanoyl-3,4-dihydropyrazol-5-yl]-4-phenyl-1H-quinolin-2-one.
| Compound Name | 6-chloro-3-[(3R)-3-(2-hydroxyphenyl)-2-propanoyl-3,4-dihydropyrazol-5-yl]-4-phenyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 136718230 |
| Molecular Formula | C27H22ClN3O3 |
| Molecular Weight | 471.94 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 6-chloro-3-[(3R)-3-(2-hydroxyphenyl)-2-propanoyl-3,4-dihydropyrazol-5-yl]-4-phenyl-1H-quinolin-2-one |
| SMILES | CCC(=O)N1N=C(c2c(-c3ccccc3)c3cc(Cl)ccc3[nH]c2=O)C[C@@H]1c1ccccc1O |
| InChI | InChI=1S/C27H22ClN3O3/c1-2-24(33)31-22(18-10-6-7-11-23(18)32)15-21(30-31)26-25(16-8-4-3-5-9-16)19-14-17(28)12-13-20(19)29-27(26)34/h3-14,22,32H,2,15H2,1H3,(H,29,34)/t22-/m1/s1 |
| InChIKey | RJECDERGMNGSGH-JOCHJYFZSA-N |
| XLogP | 5.64 |
| TPSA | 85.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.94 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|