About CID 136719157
CID 136719157 (PubChem CID 136719157) has the molecular formula C17H31O2Si
and a molecular weight of 295.52 g/mol.
Molecular Properties
| Compound Name | CID 136719157 |
| PubChem CID | 136719157 |
| Molecular Formula | C17H31O2Si |
| Molecular Weight | 295.52 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | — |
| SMILES | CC(/C=C/[Si](C(C)C)C(C)C)=C\COC1CCCCO1 |
| InChI | InChI=1S/C17H31O2Si/c1-14(2)20(15(3)4)13-10-16(5)9-12-19-17-8-6-7-11-18-17/h9-10,13-15,17H,6-8,11-12H2,1-5H3/b13-10+,16-9+ |
| InChIKey | UDOPJTMNDZUVNI-HHRAEFMESA-N |
| XLogP | 4.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze CID 136719157 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136719157?
The IUPAC name of CID 136719157 (CID 136719157) is not available.
What is the SMILES notation for CID 136719157?
The canonical SMILES for CID 136719157 is CC(/C=C/[Si](C(C)C)C(C)C)=C\COC1CCCCO1.
What is the InChIKey of CID 136719157?
The InChIKey is UDOPJTMNDZUVNI-HHRAEFMESA-N. The full InChI is InChI=1S/C17H31O2Si/c1-14(2)20(15(3)4)13-10-16(5)9-12-19-17-8-6-7-11-18-17/h9-10,13-15,17H,6-8,11-12H2,1-5H3/b13-10+,16-9+.
What are the key properties of CID 136719157?
CID 136719157 has a molecular weight of 295.52 g/mol, XLogP of 4.89, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136719157 is sourced from PubChem (CID 136719157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).